U5Y/PRD_002377
Macrocyclic peptide TDI5575
| Created: | 2020-04-23 |
| Last modified: | 2021-04-28 |
U5Y/PRD_002377 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 6WNK.
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 88 |
| Chiral Atom Count | 3 |
| Bond Count | 93 |
| Aromatic Bond Count | 24 |
Chemical Component Summary | |
|---|---|
| Name | Macrocyclic peptide TDI5575 |
| Systematic Name (OpenEye OEToolkits) | (12~{S},15~{S})-~{N}-[(2-fluorophenyl)methyl]-10,13-bis(oxidanylidene)-12-[2-oxidanylidene-2-[(2~{R})-2-phenylpyrrolidin-1-yl]ethyl]-2-oxa-11,14-diazatricyclo[15.2.2.1^{3,7}]docosa-1(19),3(22),4,6,17,20-hexaene-15-carboxamide |
| Formula | C39 H39 F N4 O5 |
| Molecular Weight | 662.749 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | C2(CCc1cccc(c1)Oc6ccc(CC(NC(C(N2)CC(N4CCCC4c3ccccc3)=O)=O)C(=O)NCc5c(F)cccc5)cc6)=O |
| SMILES | CACTVS | 3.385 | Fc1ccccc1CNC(=O)[CH]2Cc3ccc(Oc4cccc(CCC(=O)N[CH](CC(=O)N5CCC[CH]5c6ccccc6)C(=O)N2)c4)cc3 |
| SMILES | OpenEye OEToolkits | 2.0.7 | c1ccc(cc1)C2CCCN2C(=O)CC3C(=O)NC(Cc4ccc(cc4)Oc5cccc(c5)CCC(=O)N3)C(=O)NCc6ccccc6F |
| Canonical SMILES | CACTVS | 3.385 | Fc1ccccc1CNC(=O)[C@@H]2Cc3ccc(Oc4cccc(CCC(=O)N[C@@H](CC(=O)N5CCC[C@@H]5c6ccccc6)C(=O)N2)c4)cc3 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | c1ccc(cc1)[C@H]2CCCN2C(=O)C[C@H]3C(=O)N[C@@H](Cc4ccc(cc4)Oc5cccc(c5)CCC(=O)N3)C(=O)NCc6ccccc6F |
| InChI | InChI | 1.03 | InChI=1S/C39H39FN4O5/c40-32-13-5-4-11-29(32)25-41-38(47)33-23-27-15-18-30(19-16-27)49-31-12-6-8-26(22-31)17-20-36(45)42-34(39(48)43-33)24-37(46)44-21-7-14-35(44)28-9-2-1-3-10-28/h1-6,8-13,15-16,18-19,22,33-35H,7,14,17,20-21,23-25H2,(H,41,47)(H,42,45)(H,43,48)/t33-,34-,35+/m0/s1 |
| InChIKey | InChI | 1.03 | GSMYFOQUVZHNEZ-PUPDPRJKSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 138550006 |














