ATP
ADENOSINE-5'-TRIPHOSPHATE
Find entries where: ATP
is present as a standalone ligand in 2,359 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 43 entries
is present in a polymer sequence 11 entries
Chemical Component Summary | |
|---|---|
| Name | ADENOSINE-5'-TRIPHOSPHATE |
| Identifiers | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl] phosphono hydrogen phosphate |
| Formula | C10 H16 N5 O13 P3 |
| Molecular Weight | 507.181 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO[P@@](=O)(O)O[P@](=O)(O)OP(=O)(O)O)O)O)N |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 47 |
| Chiral Atom Count | 6 |
| Bond Count | 49 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB00171 |
|---|---|
| Name | ATP |
| Groups |
|
| Description | An adenine nucleotide containing three phosphate groups esterified to the sugar moiety. In addition to its crucial roles in metabolism adenosine triphosphate is a neurotransmitter. |
| Synonyms |
|
| Indication | For nutritional supplementation, also for treating dietary shortage or imbalance |
| Categories |
|
| CAS number | 56-65-5 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Multidrug resistance-associated protein 6 | MAAPAEPCAGQGVWNQTEPEPAATSLLSLCFLRTAGVWVPPMYLWVLGPI... | unknown | |
| Multidrug resistance-associated protein 4 | MLPVYQEVKPNPLQDANLCSRVFFWWLNPLFKIGHKRRLEEDDMYSVLPE... | unknown | |
| Multidrug resistance-associated protein 1 | MALRGFCSADGSDPLWDWNVTWNTSNPDFTKCFQNTVLVWVPCFYLWACF... | unknown | |
| Cystic fibrosis transmembrane conductance regulator | MQRSPLEKASVVSKLFFSWTRPILRKGYRQRLELSDIYQIPSVDSADNLS... | unknown | cofactor |
| Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform | MPPRPSSGELWGIHLMPPRILVECLLPNGMIVTLECLREATLITIKHELF... | unknown | |
| View More | |||
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 5957 |
| ChEBI | CHEBI:15422 |
| ChEMBL | CHEMBL14249 |
| Pharos | CHEMBL14249 |












