U81
5-[(3-{[(4R)-6,8-dibromo-3,4-dihydro-2H-1-benzopyran-4-yl]amino}propyl)amino]thieno[3,2-b]pyridin-7(6H)-one
Find entries where: U81
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 5-[(3-{[(4R)-6,8-dibromo-3,4-dihydro-2H-1-benzopyran-4-yl]amino}propyl)amino]thieno[3,2-b]pyridin-7(6H)-one |
| Identifiers | 5-[3-[[(4~{R})-6,8-bis(bromanyl)-3,4-dihydro-2~{H}-chromen-4-yl]amino]propylamino]-4~{H}-thieno[3,2-b]pyridin-7-one |
| Formula | C19 H19 Br2 N3 O2 S |
| Molecular Weight | 513.246 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1csc2c1NC(=CC2=O)NCCCN[C@@H]3CCOc4c3cc(cc4Br)Br |
| InChI | InChI=1S/C19H19Br2N3O2S/c20-11-8-12-14(2-6-26-18(12)13(21)9-11)22-4-1-5-23-17-10-16(25)19-15(24-17)3-7-27-19/h3,7-10,14,22H,1-2,4-6H2,(H2,23,24,25)/t14-/m1/s1 |
| InChIKey | NNTYBKTXMKBRFA-CQSZACIVSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 46 |
| Chiral Atom Count | 1 |
| Bond Count | 49 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB12262 |
|---|---|
| Name | CRS-3123 |
| Groups | investigational |
| Description | CRS3123 has been used in trials studying the treatment of Clostridial Infection and Clostridium Difficile Colitis. |
| Synonyms | CRS-3123 |
| Categories |
|
| CAS number | 1013915-71-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 16744283 |
| ChEMBL | CHEMBL4297370 |
