Chemical Component Summary | |
|---|---|
| Name | L(+)-TARTARIC ACID |
| Identifiers | (2R,3R)-2,3-dihydroxybutanedioic acid |
| Formula | C4 H6 O6 |
| Molecular Weight | 150.09 |
| Type | NON-POLYMER |
| Isomeric SMILES | O[C@H]([C@@H](O)C(O)=O)C(O)=O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 16 |
| Chiral Atom Count | 2 |
| Bond Count | 15 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB09459 |
|---|---|
| Name | L-tartaric acid |
| Groups | experimental |
| Description | Tartaric acid is a white crystalline organic acid that occurs naturally in many plants, most notably in grapes.Tartaric is an alpha-hydroxy-carboxylic acid, is diprotic and aldaric in acid characteristics, and is a dihydroxyl derivative of succinic acid. |
| Synonyms |
|
| Brand Names |
|
| Indication | Tartaric Acid is primarily indicated in conditions like Antiscorbutic, Antiseptic. |
| Categories |
|
| CAS number | 87-69-4 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 | MPKRRDILAIVLIVLPWTLLITVWHQSTLAPLLAVHKDEGSDPRRETPPG... | unknown | catalytic activity |
| Hypoxia-inducible factor 1-alpha inhibitor | MAATAAEAVASGSGEPREEAGALGPAWDESQLRSYSFPTRPIPRLSQSDP... | unknown | catalytic activity |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
