TLA
L(+)-TARTARIC ACID
Find entries where: TLA
is present as a standalone ligand in 512 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 7 entries
Chemical Component Summary | |
|---|---|
| Name | L(+)-TARTARIC ACID |
| Identifiers | (2R,3R)-2,3-dihydroxybutanedioic acid |
| Formula | C4 H6 O6 |
| Molecular Weight | 150.09 |
| Type | NON-POLYMER |
| Isomeric SMILES | [C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 16 |
| Chiral Atom Count | 2 |
| Bond Count | 15 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB09459 |
|---|---|
| Name | L-tartaric acid |
| Groups | experimental |
| Description | Tartaric acid is a white crystalline organic acid that occurs naturally in many plants, most notably in grapes.Tartaric is an alpha-hydroxy-carboxylic acid, is diprotic and aldaric in acid characteristics, and is a dihydroxyl derivative of succinic acid. |
| Synonyms |
|
| Brand Names |
|
| Indication | Tartaric Acid is primarily indicated in conditions like Antiscorbutic, Antiseptic. |
| Categories |
|
| CAS number | 87-69-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| CCDC/CSD | FINTAZ02 |
| PubChem | 444305 |
| ChEBI | CHEBI:15671 |
| ChEMBL | CHEMBL1236315 |
