QOE/PRD_002578
(2~{S},3~{R})-~{N}-[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]-3-oxidanyl-2-(3-phenylpropanoylamino)butanamide
| Created: | 2020-07-09 |
| Last modified: | 2024-09-27 |
QOE/PRD_002578 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 6ZP8.
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 70 |
| Chiral Atom Count | 5 |
| Bond Count | 71 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | (2~{S},3~{R})-~{N}-[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]-3-oxidanyl-2-(3-phenylpropanoylamino)butanamide |
| Synonyms | HB335 |
| Systematic Name (OpenEye OEToolkits) | (2~{S},3~{R})-~{N}-[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]-3-oxidanyl-2-(3-phenylpropanoylamino)butanamide |
| Formula | C24 H36 N4 O6 |
| Molecular Weight | 476.566 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | C[CH](O)[CH](NC(=O)CCc1ccccc1)C(=O)N[CH]2C[CH](O)CCNC(=O)CC[CH](C)NC2=O |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC1CCC(=O)NCCC(CC(C(=O)N1)NC(=O)C(C(C)O)NC(=O)CCc2ccccc2)O |
| Canonical SMILES | CACTVS | 3.385 | C[C@@H](O)[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@H]2C[C@@H](O)CCNC(=O)CC[C@H](C)NC2=O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | C[C@H]1CCC(=O)NCC[C@@H](C[C@@H](C(=O)N1)NC(=O)[C@H]([C@@H](C)O)NC(=O)CCc2ccccc2)O |
| InChI | InChI | 1.03 | InChI=1S/C24H36N4O6/c1-15-8-10-20(31)25-13-12-18(30)14-19(23(33)26-15)27-24(34)22(16(2)29)28-21(32)11-9-17-6-4-3-5-7-17/h3-7,15-16,18-19,22,29-30H,8-14H2,1-2H3,(H,25,31)(H,26,33)(H,27,34)(H,28,32)/t15-,16+,18-,19-,22-/m0/s1 |
| InChIKey | InChI | 1.03 | MYKWJGODZLZGEA-MHRUYAEQSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 155923716 |














