QOB/PRD_002580
~{N}-[(2~{S},3~{R})-1-[[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]amino]-3-oxidanyl-1-oxidanylidene-butan-2-yl]-5-phenyl-pentanamide
| Created: | 2020-07-09 |
| Last modified: | 2024-09-27 |
QOB/PRD_002580 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 6ZP6.
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 76 |
| Chiral Atom Count | 5 |
| Bond Count | 77 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | ~{N}-[(2~{S},3~{R})-1-[[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]amino]-3-oxidanyl-1-oxidanylidene-butan-2-yl]-5-phenyl-pentanamide |
| Synonyms | Syrbactin inhibitor; HB334 |
| Systematic Name (OpenEye OEToolkits) | ~{N}-[(2~{S},3~{R})-1-[[(5~{S},8~{S},10~{S})-5-methyl-10-oxidanyl-2,7-bis(oxidanylidene)-1,6-diazacyclododec-8-yl]amino]-3-oxidanyl-1-oxidanylidene-butan-2-yl]-5-phenyl-pentanamide |
| Formula | C26 H40 N4 O6 |
| Molecular Weight | 504.619 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | C[CH](O)[CH](NC(=O)CCCCc1ccccc1)C(=O)N[CH]2C[CH](O)CCNC(=O)CC[CH](C)NC2=O |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC1CCC(=O)NCCC(CC(C(=O)N1)NC(=O)C(C(C)O)NC(=O)CCCCc2ccccc2)O |
| Canonical SMILES | CACTVS | 3.385 | C[C@@H](O)[C@H](NC(=O)CCCCc1ccccc1)C(=O)N[C@H]2C[C@@H](O)CCNC(=O)CC[C@H](C)NC2=O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | C[C@H]1CCC(=O)NCC[C@@H](C[C@@H](C(=O)N1)NC(=O)[C@H]([C@@H](C)O)NC(=O)CCCCc2ccccc2)O |
| InChI | InChI | 1.03 | InChI=1S/C26H40N4O6/c1-17-12-13-22(33)27-15-14-20(32)16-21(25(35)28-17)29-26(36)24(18(2)31)30-23(34)11-7-6-10-19-8-4-3-5-9-19/h3-5,8-9,17-18,20-21,24,31-32H,6-7,10-16H2,1-2H3,(H,27,33)(H,28,35)(H,29,36)(H,30,34)/t17-,18+,20-,21-,24-/m0/s1 |
| InChIKey | InChI | 1.03 | WMBRGTCTXHPVLU-KGLBSCIUSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 155923715 |














