Chemical Component Summary | |
|---|---|
| Name | Benziodarone |
| Synonyms | Amplivix; Dilafurane |
| Identifiers | [3,5-bis(iodanyl)-4-oxidanyl-phenyl]-(2-ethyl-1-benzofuran-3-yl)methanone |
| Formula | C17 H12 I2 O3 |
| Molecular Weight | 518.084 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1c(c2ccccc2o1)C(=O)c3cc(c(c(c3)I)O)I |
| InChI | InChI=1S/C17H12I2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| InChIKey | CZCHIEJNWPNBDE-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 34 |
| Chiral Atom Count | 0 |
| Bond Count | 36 |
| Aromatic Bond Count | 16 |
Drug Info: DrugBank
| DrugBank ID | DB13277 |
|---|---|
| Name | Benziodarone |
| Groups |
|
| Description | Benziodarone is a uricostatic and a uricosuric agent which is sold also under the name Amplivex-Labaz. It is used in the treatment of gout [A175630]. It was withdrawn from France markets and British markets due to its effects causing Jaundice in patients [T487, A175636]. |
| Synonyms | Benziodarone |
| Categories |
|
| ATC-Code |
|
| CAS number | 68-90-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 6237 |
| ChEMBL | CHEMBL232201 |
| ChEBI | CHEBI:135814 |
| CCDC/CSD | SATJOM |
