Chemical Component Summary | |
|---|---|
| Name | trichloromethane |
| Synonyms | Chloroform CHCl3 |
| Identifiers | trichloromethane |
| Formula | C H Cl3 |
| Molecular Weight | 119.38 |
| Type | NON-POLYMER |
| Isomeric SMILES | C(Cl)(Cl)Cl |
| InChI | InChI=1S/CHCl3/c2-1(3)4/h1H |
| InChIKey | HEDRZPFGACZZDS-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 5 |
| Chiral Atom Count | 0 |
| Bond Count | 4 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB11387 |
|---|---|
| Name | Chloroform |
| Groups |
|
| Description | Chloroform is an organic small molecule, member of the family of the chloromethanes that presents a formula of CHCl3. It is a colorless, sweet-smelling, dense liquid that is produced on a large scale as a precursor to PTFE and refrigerants, but the latter application is declining. |
| Synonyms |
|
| Categories |
|
| ATC-Code | N01AB02 |
| CAS number | 67-66-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| CCDC/CSD | ACIYES |
| PubChem | 6212 |
| ChEBI | CHEBI:35255 |
| ChEMBL | CHEMBL44618 |
