JER
(2~{S})-3-[4-[5-(2-cyclopentyl-6-methoxy-pyridin-4-yl)-1,2,4-oxadiazol-3-yl]-2-ethyl-6-methyl-phenoxy]propane-1,2-diol
Find entries where: JER
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (2~{S})-3-[4-[5-(2-cyclopentyl-6-methoxy-pyridin-4-yl)-1,2,4-oxadiazol-3-yl]-2-ethyl-6-methyl-phenoxy]propane-1,2-diol |
| Identifiers | (2~{S})-3-[4-[5-(2-cyclopentyl-6-methoxy-pyridin-4-yl)-1,2,4-oxadiazol-3-yl]-2-ethyl-6-methyl-phenoxy]propane-1,2-diol |
| Formula | C25 H31 N3 O5 |
| Molecular Weight | 453.531 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1cc(cc(c1OC[C@H](CO)O)C)c2nc(on2)c3cc(nc(c3)OC)C4CCCC4 |
| InChI | InChI=1S/C25H31N3O5/c1-4-16-10-18(9-15(2)23(16)32-14-20(30)13-29)24-27-25(33-28-24)19-11-21(17-7-5-6-8-17)26-22(12-19)31-3/h9-12,17,20,29-30H,4-8,13-14H2,1-3H3/t20-/m0/s1 |
| InChIKey | KJKKMMMRWISKRF-FQEVSTJZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 64 |
| Chiral Atom Count | 1 |
| Bond Count | 67 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB12705 |
|---|---|
| Name | Cenerimod |
| Groups | investigational |
| Description | Cenerimod has been used in trials studying the treatment of Systemic Lupus Erythematosus. |
| Synonyms | Cenerimod |
| Categories |
|
| CAS number | 1262414-04-9 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 49871973 |
| ChEMBL | CHEMBL4297505 |
