GO6
(2R,3R)-2,3-bis[(3-methoxy-4-oxidanyl-phenyl)methyl]butane-1,4-diol
| Created: | 2020-09-04 |
| Last modified: | 2021-06-09 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 52 |
| Chiral Atom Count | 2 |
| Bond Count | 53 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | (2R,3R)-2,3-bis[(3-methoxy-4-oxidanyl-phenyl)methyl]butane-1,4-diol |
| Synonyms | (-)-secoisolariciresinol |
| Systematic Name (OpenEye OEToolkits) | (2~{R},3~{R})-2,3-bis[(3-methoxy-4-oxidanyl-phenyl)methyl]butane-1,4-diol |
| Formula | C20 H26 O6 |
| Molecular Weight | 362.417 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | COc1cc(C[CH](CO)[CH](CO)Cc2ccc(O)c(OC)c2)ccc1O |
| SMILES | OpenEye OEToolkits | 2.0.7 | COc1cc(ccc1O)CC(CO)C(Cc2ccc(c(c2)OC)O)CO |
| Canonical SMILES | CACTVS | 3.385 | COc1cc(C[C@@H](CO)[C@H](CO)Cc2ccc(O)c(OC)c2)ccc1O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | COc1cc(ccc1O)C[C@@H](CO)[C@@H](Cc2ccc(c(c2)OC)O)CO |
| InChI | InChI | 1.03 | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | InChI | 1.03 | PUETUDUXMCLALY-HOTGVXAUSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB12179 |
|---|---|
| Name | Secoisolariciresinol |
| Groups | investigational |
| Description | Secoisolariciresinol has been used in trials studying the prevention of Breast Cancer. |
| Synonyms | Secoisolariciresinol |
| Categories |
|
| CAS number | 29388-59-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 65373 |
| ChEMBL | CHEMBL368347 |
| ChEBI | CHEBI:65004 |
| CCDC/CSD | CAYHAL |














