Chemical Component Summary

Name1-PHENYL-2-AMINOPROPANE
Identifiers(2R)-1-phenylpropan-2-amine
FormulaC9 H13 N
Molecular Weight135.21
TypeL-PEPTIDE LINKING
Isomeric SMILESC[C@@H](N)Cc1ccccc1
InChIInChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1
InChIKeyKWTSXDURSIMDCE-MRVPVSSYSA-N

Chemical Details

Formal Charge0
Atom Count23
Chiral Atom Count1
Bond Count23
Aromatic Bond Count6