Chemical Component Summary

NameFORMYCIN B
Identifiers3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,6-dihydropyrazolo[5,4-e]pyrimidin-7-one
FormulaC10 H12 N4 O5
Molecular Weight268.23
TypeNON-POLYMER
Isomeric SMILESOC[C@H]1O[C@H]([C@H](O)[C@@H]1O)c1n[nH]c2c1nc[nH]c2=O
InChIInChI=1S/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7-,8-,9+/m1/s1
InChIKeyMTCJZZBQNCXKAP-KSYZLYKTSA-N

Chemical Details

Formal Charge0
Atom Count31
Chiral Atom Count4
Chiral AtomsC1', C2', C3', C4'
Bond Count33
Aromatic Bond Count10
Leaving Atomsn/a