EZI
4-(7-Hydroxy-2-isopropyl-4-oxoquinazolin-3(4H)-yl)benzonitrile
| Created: | 2023-06-20 |
| Last modified: | 2024-08-14 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 38 |
| Chiral Atom Count | 0 |
| Bond Count | 40 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 4-(7-Hydroxy-2-isopropyl-4-oxoquinazolin-3(4H)-yl)benzonitrile |
| Synonyms | Vanilloid receptor antagonist 1; Libvatrep |
| Systematic Name (OpenEye OEToolkits) | 4-(7-oxidanyl-4-oxidanylidene-2-propan-2-yl-quinazolin-3-yl)benzenecarbonitrile |
| Formula | C18 H15 N3 O2 |
| Molecular Weight | 305.331 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CC(C)C1=Nc2cc(O)ccc2C(=O)N1c3ccc(cc3)C#N |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)C1=Nc2cc(ccc2C(=O)N1c3ccc(cc3)C#N)O |
| Canonical SMILES | CACTVS | 3.385 | CC(C)C1=Nc2cc(O)ccc2C(=O)N1c3ccc(cc3)C#N |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)C1=Nc2cc(ccc2C(=O)N1c3ccc(cc3)C#N)O |
| InChI | InChI | 1.06 | InChI=1S/C18H15N3O2/c1-11(2)17-20-16-9-14(22)7-8-15(16)18(23)21(17)13-5-3-12(10-19)4-6-13/h3-9,11,22H,1-2H3 |
| InChIKey | InChI | 1.06 | JFPXRFIBKKSHGY-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB21488 |
|---|---|
| Name | Libvatrep |
| Groups | experimental |
| Description | Libvatrep is a small molecule drug. The usage of the INN stem '-vatrep' in the name indicates that Libvatrep is a transient receptor potential vanilloid (TRPV) antagonist. Libvatrep has a monoisotopic molecular weight of 305.12 Da. |
| Synonyms | Libvatrep |
| CAS number | 871814-52-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 25138363 |














