CHL
CHLOROPHYLL B
| Created: | 1999-07-08 |
| Last modified: | 2026-09-01 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 136 |
| Chiral Atom Count | 5 |
| Bond Count | 144 |
| Aromatic Bond Count | 5 |
Chemical Component Summary | |
|---|---|
| Name | CHLOROPHYLL B |
| Formula | C55 H70 Mg N4 O6 |
| Molecular Weight | 907.472 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CCC1=C(C=O)C2=Cc3n4c(C=C5[CH](C)[CH](CCC(=O)OCC=C(C)CCC[CH](C)CCC[CH](C)CCCC(C)C)C6=[N+]5[Mg]47[N]8C(=CC1=[N+]27)C(=C9C(=O)[CH](C(=O)OC)C6=C89)C)c(C)c3C=C |
| SMILES | OpenEye OEToolkits | 2.0.7 | CCC1=C(c2cc3c(c(c4n3[Mg]56[n+]2c1cc7n5c8c(c9[n+]6c(c4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C(C(=O)c8c7C)C(=O)OC)C)C=C)C=O |
| Canonical SMILES | CACTVS | 3.385 | CCC1=C(C=O)C2=Cc3n4c(C=C5[C@H](C)[C@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C6=[N@+]5[Mg]47[N@@]8C(=CC1=[N@+]27)C(=C9C(=O)[C@H](C(=O)OC)C6=C89)C)c(C)c3C=C |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CCC1=C(c2cc3c(c(c4n3[Mg]56[n+]2c1cc7n5c8c(c9[n+]6c(c4)C(C9CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)[C@H](C(=O)c8c7C)C(=O)OC)C)C=C)C=O |
| InChI | InChI | 1.03 | InChI=1S/C55H71N4O6.Mg/c1-12-38-35(8)42-27-43-36(9)40(23-24-48(61)65-26-25-34(7)22-16-21-33(6)20-15-19-32(5)18-14-17-31(3)4)52(58-43)50-51(55(63)64-11)54(62)49-37(10)44(59-53(49)50)28-46-39(13-2)41(30-60)47(57-46)29-45(38)56-42;/h12,25,27-33,36,40,51H,1,13-24,26H2,2-11H3,(H-,56,57,58,59,60,62);/q-1;+4/p-1/b34-25+;/t32-,33-,36?,40?,51-;/m1./s1 |
| InChIKey | InChI | 1.03 | MWVCRINOIIOUAU-UYSPMESUSA-M |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB04506 |
|---|---|
| Name | Chlorophyll B |
| Groups | experimental |
| Description | A light, silvery, metallic element. It has the atomic symbol Mg, atomic number 12, and atomic weight 24.31. Its salts are essential in nutrition, being required for the activity of many enzymes, especially those concerned with oxidative phosphorylation. It is a component of both intra- and extracellular fluids and is excreted in the urine and feces. Deficiency causes irritability of the nervous system with tetany, vasodilation, convulsions, tremors, depression, and psychotic behavior. (From Dorland, 27th ed) |
| Synonyms | Chlorophyll B |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 519-62-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 46926108, 11593175, 13557930 |














