Chemical Component Summary

NameBACTERIOPHEOPHYTIN B
Identifiersn/a
FormulaC55 H74 N4 O6
Molecular Weight887.20
TypeNON-POLYMER
Isomeric SMILESC/C=C\1/c2/cc\3/c(c4c([nH]3)c(c5n/c(c\c6c(c(c([nH]6)/cc(\n2)/C1C)C(=O)C)C)/C(C5CCC(=O)OC/C=C(\C)/CCCC(C)CCCC(C)CCCC(C)C)C)C(C4=O)C(=O)OC)C
InChIInChI=1S/C55H74N4O6/c1-13-39-34(7)41-29-46-48(38(11)60)36(9)43(57-46)27-42-35(8)40(52(58-42)50-51(55(63)64-12)54(62)49-37(10)44(59-53(49)50)28-45(39)56-41)23-24-47(61)65-26-25-33(6)22-16-21-32(5)20-15-19-31(4)18-14-17-30(2)3/h13,25,27-32,34-35,40,51,57,59H,14-24,26H2,1-12H3/b33-25+,39-13+,41-29-,42-27-,43-27-,44-28-,45-28-,46-29-,52-50-/t31-,32-,34-,35+,40+,51-/m1/s1
InChIKeySFKCKJXMIAKQMY-GTTFDWDMSA-N

Chemical Details

Formal Charge0
Atom Count139
Chiral Atom Count6
Bond Count144
Aromatic Bond Count22