Chemical Component Summary

NameLEUCINE BORONIC ACID
Identifiers[(1R)-1-azanyl-3-methyl-butyl]boronic acid
FormulaC5 H14 B N O2
Molecular Weight130.98
Typepeptide-like
Isomeric SMILESCC(C)C[C@H](N)B(O)O
InChIInChI=1S/C5H14BNO2/c1-4(2)3-5(7)6(8)9/h4-5,8-9H,3,7H2,1-2H3/t5-/m0/s1
InChIKeyBMGMQYRPZOGZFU-YFKPBYRVSA-N

Chemical Details

Formal Charge0
Atom Count23
Chiral Atom Count1
Chiral AtomsCA
Bond Count22
Aromatic Bond Count0
Leaving AtomsHN2