A1AIK
dotinurad
| Created: | 2024-03-19 |
| Last modified: | 2024-09-18 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 31 |
| Chiral Atom Count | 0 |
| Bond Count | 33 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | dotinurad |
| Synonyms | 3-(3,5-dichloro-4-hydroxybenzoyl)-2,3-dihydro-1H-1lambda~6~,3-benzothiazole-1,1-dione |
| Systematic Name (OpenEye OEToolkits) | [3,5-bis(chloranyl)-4-oxidanyl-phenyl]-[1,1-bis(oxidanylidene)-2~{H}-1,3-benzothiazol-3-yl]methanone |
| Formula | C14 H9 Cl2 N O4 S |
| Molecular Weight | 358.197 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | Clc1cc(cc(Cl)c1O)C(=O)N1CS(=O)(=O)c2ccccc21 |
| SMILES | CACTVS | 3.385 | Oc1c(Cl)cc(cc1Cl)C(=O)N2C[S](=O)(=O)c3ccccc23 |
| SMILES | OpenEye OEToolkits | 2.0.7 | c1ccc2c(c1)N(CS2(=O)=O)C(=O)c3cc(c(c(c3)Cl)O)Cl |
| Canonical SMILES | CACTVS | 3.385 | Oc1c(Cl)cc(cc1Cl)C(=O)N2C[S](=O)(=O)c3ccccc23 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | c1ccc2c(c1)N(CS2(=O)=O)C(=O)c3cc(c(c(c3)Cl)O)Cl |
| InChI | InChI | 1.06 | InChI=1S/C14H9Cl2NO4S/c15-9-5-8(6-10(16)13(9)18)14(19)17-7-22(20,21)12-4-2-1-3-11(12)17/h1-6,18H,7H2 |
| InChIKey | InChI | 1.06 | VOFLAIHEELWYGO-UHFFFAOYSA-N |
Drug Info: DrugBank
| DrugBank ID | DB16145 |
|---|---|
| Name | Dotinurad |
| Groups | investigational |
| Description | Dotinurad is under investigation in clinical trial NCT03372200 (Febuxostat-controlled, Double-blind, Comparative Study of FYU-981 in Hyperuricemia With or Without Gout). |
| Synonyms | Dotinurad |
| Categories |
|
| CAS number | 1285572-51-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4594446 |
| PubChem | 51349053 |
| ChEMBL | CHEMBL4594446 |
