9IG
3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine
| Created: | 2021-10-15 |
| Last modified: | 2022-01-19 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 1 |
| Bond Count | 44 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine |
| Systematic Name (OpenEye OEToolkits) | 3-(2-chlorophenyl)-~{N}-[(1~{R})-1-(3-methoxyphenyl)ethyl]propan-1-amine |
| Formula | C18 H22 Cl N O |
| Molecular Weight | 303.826 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | Clc1ccccc1CCCNC(C)c1cccc(OC)c1 |
| SMILES | CACTVS | 3.385 | COc1cccc(c1)[CH](C)NCCCc2ccccc2Cl |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC(c1cccc(c1)OC)NCCCc2ccccc2Cl |
| Canonical SMILES | CACTVS | 3.385 | COc1cccc(c1)[C@@H](C)NCCCc2ccccc2Cl |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | C[C@H](c1cccc(c1)OC)NCCCc2ccccc2Cl |
| InChI | InChI | 1.03 | InChI=1S/C18H22ClNO/c1-14(16-8-5-10-17(13-16)21-2)20-12-6-9-15-7-3-4-11-18(15)19/h3-5,7-8,10-11,13-14,20H,6,9,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | InChI | 1.03 | ZVQUCWXZCKWZBP-CQSZACIVSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB20329 |
|---|---|
| Name | Tecalcet |
| Groups | experimental |
| Description | Tecalcet is a small molecule drug. The usage of the INN stem '-calcet/-calcet-' in the name indicates that Tecalcet is a calcium-sensing receptor (CaSR) agonist. Tecalcet has a monoisotopic molecular weight of 303.14 Da. |
| Synonyms | Tecalcet |
| CAS number | 148717-54-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL292376 |
| PubChem | 158797 |
| ChEMBL | CHEMBL292376 |
