83E/PRD_002486
Gallinamide A analog
| Created: | 2021-09-03 |
| Last modified: | 2024-09-27 |
83E/PRD_002486 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 7S18.
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 127 |
| Chiral Atom Count | 5 |
| Bond Count | 130 |
| Aromatic Bond Count | 18 |
Chemical Component Summary | |
|---|---|
| Name | Gallinamide A analog |
| Systematic Name (OpenEye OEToolkits) | (2~{S})-2-[[(2~{S})-2-[[(2~{S})-2-(dimethylamino)-3-methyl-butanoyl]amino]-4-methyl-pentanoyl]amino]-~{N}-[(3~{S})-6-[(2~{S})-3-methoxy-5-oxidanylidene-2-[(4-phenylphenyl)methyl]-2~{H}-pyrrol-1-yl]-6-oxidanylidene-1-phenyl-hexan-3-yl]-4-methyl-pentanamide |
| Formula | C49 H67 N5 O6 |
| Molecular Weight | 822.086 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=C(CCC(CCc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)N(C)C)N1C(=O)C=C(OC)C1Cc1ccc(cc1)c1ccccc1 |
| SMILES | CACTVS | 3.385 | COC1=CC(=O)N([CH]1Cc2ccc(cc2)c3ccccc3)C(=O)CC[CH](CCc4ccccc4)NC(=O)[CH](CC(C)C)NC(=O)[CH](CC(C)C)NC(=O)[CH](C(C)C)N(C)C |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)CC(C(=O)NC(CCc1ccccc1)CCC(=O)N2C(C(=CC2=O)OC)Cc3ccc(cc3)c4ccccc4)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)N(C)C |
| Canonical SMILES | CACTVS | 3.385 | COC1=CC(=O)N([C@H]1Cc2ccc(cc2)c3ccccc3)C(=O)CC[C@H](CCc4ccccc4)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)N(C)C |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)C[C@@H](C(=O)N[C@@H](CCc1ccccc1)CCC(=O)N2[C@H](C(=CC2=O)OC)Cc3ccc(cc3)c4ccccc4)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)N(C)C |
| InChI | InChI | 1.03 | InChI=1S/C49H67N5O6/c1-32(2)28-40(51-48(58)41(29-33(3)4)52-49(59)46(34(5)6)53(7)8)47(57)50-39(25-22-35-16-12-10-13-17-35)26-27-44(55)54-42(43(60-9)31-45(54)56)30-36-20-23-38(24-21-36)37-18-14-11-15-19-37/h10-21,23-24,31-34,39-42,46H,22,25-30H2,1-9H3,(H,50,57)(H,51,58)(H,52,59)/t39-,40-,41-,42-,46-/m0/s1 |
| InChIKey | InChI | 1.03 | JLQMIAJVDKBAJR-BFALPNPBSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 162677681 |














