6FS
N-[2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)phenyl]glycine
Find entries where: 6FS
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | N-[2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)phenyl]glycine |
| Identifiers | 2-[[2-methoxy-5-[[(~{E})-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]amino]ethanoic acid |
| Formula | C21 H25 N O8 S |
| Molecular Weight | 451.49 |
| Type | NON-POLYMER |
| Isomeric SMILES | COc1ccc(cc1NCC(=O)O)CS(=O)(=O)/C=C/c2c(cc(cc2OC)OC)OC |
| InChI | InChI=1S/C21H25NO8S/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-31(25,26)13-14-5-6-18(28-2)17(9-14)22-12-21(23)24/h5-11,22H,12-13H2,1-4H3,(H,23,24)/b8-7+ |
| InChIKey | OWBFCJROIKNMGD-BQYQJAHWSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 0 |
| Bond Count | 57 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12146 |
|---|---|
| Name | Rigosertib |
| Groups | investigational |
| Description | Rigosertib has been used in trials studying the treatment and basic science of MDS, RAEB, Cancer, Hepatoma, and Neoplasms, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 592542-59-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL1241855 |
| PubChem | 6918736 |
| ChEMBL | CHEMBL1241855 |
| ChEBI | CHEBI:124939, CHEBI:145417 |
