3OJ
4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy]benzene-1,2-dicarbonitrile
Find entries where: 3OJ
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy]benzene-1,2-dicarbonitrile |
| Identifiers | 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzene-1,2-dicarbonitrile |
| Formula | C15 H9 B N2 O3 |
| Molecular Weight | 276.055 |
| Type | NON-POLYMER |
| Isomeric SMILES | B1(c2ccc(cc2CO1)Oc3ccc(c(c3)C#N)C#N)O |
| InChI | InChI=1S/C15H9BN2O3/c17-7-10-1-2-13(5-11(10)8-18)21-14-3-4-15-12(6-14)9-20-16(15)19/h1-6,19H,9H2 |
| InChIKey | UBMGTTRDNUKZMT-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 30 |
| Chiral Atom Count | 0 |
| Bond Count | 32 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB16039 |
|---|---|
| Name | AN2898 |
| Groups | investigational |
| Description | AN2898 is under investigation in clinical trial NCT01301508 (Efficacy and Safety of AN2898 and AN2728 Topical Ointments to Treat Mild-to-moderate Atopic Dermatitis). |
| Synonyms | AN2898 |
| CAS number | 906673-33-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 24806574 |
