2OW
methyl 4-(2-fluoro-3-{[(6-methylpyridin-3-yl)carbamoyl]amino}benzyl)piperazine-1-carboxylate
Find entries where: 2OW
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | methyl 4-(2-fluoro-3-{[(6-methylpyridin-3-yl)carbamoyl]amino}benzyl)piperazine-1-carboxylate |
| Synonyms | omecamtiv mercarbil |
| Identifiers | methyl 4-[[2-fluoranyl-3-[(6-methylpyridin-3-yl)carbamoylamino]phenyl]methyl]piperazine-1-carboxylate |
| Formula | C20 H24 F N5 O3 |
| Molecular Weight | 401.435 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1ccc(cn1)NC(=O)Nc2cccc(c2F)CN3CCN(CC3)C(=O)OC |
| InChI | InChI=1S/C20H24FN5O3/c1-14-6-7-16(12-22-14)23-19(27)24-17-5-3-4-15(18(17)21)13-25-8-10-26(11-9-25)20(28)29-2/h3-7,12H,8-11,13H2,1-2H3,(H2,23,24,27) |
| InChIKey | RFUBTTPMWSKEIW-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 53 |
| Chiral Atom Count | 0 |
| Bond Count | 55 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB11816 |
|---|---|
| Name | Omecamtiv Mecarbil |
| Groups | investigational |
| Description | Omecamtiv Mecarbil has been used in trials studying the treatment and basic science of Heart Failure, Echocardiogram, Pharmacokinetics, Chronic Heart Failure, and History of Chronic Heart Failure, among others. |
| Synonyms | Omecamtiv Mecarbil |
| Categories | Amides |
| CAS number | 873697-71-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 11689883 |
| ChEMBL | CHEMBL1800955 |
