0LM: N-(4-chloro-3-fluorophenyl)-N'-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanediamide
0LM is a Ligand Of Interest in 4DKO designated by the RCSB
| Best-fitted instance in this entry |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
| 4DKO_0LM_A_513 | 8% | 2% | 0.307 | 0.802 | 2.46 | 4.17 | 9 | 10 | 1 | 0 | 100% | 1 |
| 4DKO_0LM_C_513 | 6% | 2% | 0.322 | 0.776 | 2.42 | 4.47 | 9 | 9 | 2 | 0 | 100% | 1 |