CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH C1=CN(N=C(C1=O)c2ccnn2c3c4c(ccc3)cccc4)c5cc(ccc5)OC(F)(F)F, micromolar IC50=0.002773
External Resource: Annotation
| Chains | Family Name | Domain Identifier | Architecture | Possible Homology | Homology | Topology | Family | Provenance Source (Version) |
| A | PDEase_I | e5si4A1 | A: a/b three-layered sandwiches | X: RNase A-like | H: Cytochrome P450 | T: Cytochrome P450 | F: PDEase_I | ECOD (v294.1) |
| C | PDEase_I | e5si4C1 | A: a/b three-layered sandwiches | X: RNase A-like | H: Cytochrome P450 | T: Cytochrome P450 | F: PDEase_I | ECOD (v294.1) |
| D | PDEase_I | e5si4D1 | A: a/b three-layered sandwiches | X: RNase A-like | H: Cytochrome P450 | T: Cytochrome P450 | F: PDEase_I | ECOD (v294.1) |
| B | PDEase_I | e5si4B1 | A: a/b three-layered sandwiches | X: RNase A-like | H: Cytochrome P450 | T: Cytochrome P450 | F: PDEase_I | ECOD (v294.1) |
| Chains | Polymer | Molecular Function | Biological Process | Cellular Component |
|---|
| cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | | | |
| Chains | Drug Target   | Associated Disease |
|---|
| Pharos:  Q9Y233 | |