PRD_002597
Microcolin H
| Created: | 2025-11-27 |
| Last modified: | 2026-02-04 |
PRD_002597 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is PDB_00009TA5.
Find Related PDB Entries |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 117 |
| Chiral Atom Count | 8 |
| Bond Count | 118 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | Microcolin H |
| Systematic Name (OpenEye OEToolkits) | [(2~{R},3~{S})-3-[[(2~{S})-4-methyl-2-[methyl-[(2~{R})-2-methyloctanoyl]amino]pentanoyl]amino]-4-[methyl-[(2~{S})-3-methyl-1-[(2~{S},4~{S})-2-[(2~{S})-2-methyl-5-oxidanylidene-pyrrolidin-1-yl]carbonyl-4-oxidanyl-pyrrolidin-1-yl]-1-oxidanylidene-butan-2-yl]amino]-4-oxidanylidene-butan-2-yl] ethanoate |
| Formula | C38 H65 N5 O9 |
| Molecular Weight | 735.951 |
| Type | PEPTIDE-LIKE |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CCCCCC[CH](C)C(=O)N(C)[CH](CC(C)C)C(=O)N[CH]([CH](C)OC(C)=O)C(=O)N(C)[CH](C(C)C)C(=O)N1C[CH](O)C[CH]1C(=O)N2[CH](C)CCC2=O |
| SMILES | OpenEye OEToolkits | 2.0.7 | CCCCCCC(C)C(=O)N(C)C(CC(C)C)C(=O)NC(C(C)OC(=O)C)C(=O)N(C)C(C(C)C)C(=O)N1CC(CC1C(=O)N2C(CCC2=O)C)O |
| Canonical SMILES | CACTVS | 3.385 | CCCCCC[C@@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)OC(C)=O)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C[C@@H](O)C[C@H]1C(=O)N2[C@@H](C)CCC2=O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CCCCCC[C@@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)OC(=O)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C[C@H](C[C@H]1C(=O)N2[C@H](CCC2=O)C)O |














