CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH C4CCN(c1cn(c(n1)CCc3nn2c(ncc(c2n3)C)C)C)C4=O, micromolar IC50=0.039238
Domain Annotation: ECOD Classification ECOD Database Homepage
| Chains | Family Name | Domain Identifier | Architecture | Possible Homology | Homology | Topology | Family | Provenance Source (Version) |
|---|---|---|---|---|---|---|---|---|
| C | PDEase_I | e5sjgC1 | A: alpha complex topology | X: PDEase-like | H: HD-domain/PDEase-like (From Topology) | T: HD-domain/PDEase-like | F: PDEase_I | ECOD (1.6) |
| D | PDEase_I | e5sjgD1 | A: alpha complex topology | X: PDEase-like | H: HD-domain/PDEase-like (From Topology) | T: HD-domain/PDEase-like | F: PDEase_I | ECOD (1.6) |
| B | PDEase_I | e5sjgB1 | A: alpha complex topology | X: PDEase-like | H: HD-domain/PDEase-like (From Topology) | T: HD-domain/PDEase-like | F: PDEase_I | ECOD (1.6) |
| A | PDEase_I | e5sjgA1 | A: alpha complex topology | X: PDEase-like | H: HD-domain/PDEase-like (From Topology) | T: HD-domain/PDEase-like | F: PDEase_I | ECOD (1.6) |
Protein Family Annotation Pfam Database Homepage
| Chains | Accession | Name | Description | Comments | Source |
|---|---|---|---|---|---|
| PF00233 | 3'5'-cyclic nucleotide phosphodiesterase (PDEase_I) | 3'5'-cyclic nucleotide phosphodiesterase | Domain | ||
| PF00233 | 3'5'-cyclic nucleotide phosphodiesterase (PDEase_I) | 3'5'-cyclic nucleotide phosphodiesterase | Domain |
Gene Ontology: Gene Product Annotation Gene Ontology Database Homepage
InterPro: Protein Family Classification InterPro Database Homepage
| Chains | Accession | Name | Type |
|---|---|---|---|
| IPR003607 | HD/PDEase domain | Domain | |
| IPR002073 | 3'5'-cyclic nucleotide phosphodiesterase, catalytic domain | Domain | |
| IPR036971 | 3'5'-cyclic nucleotide phosphodiesterase, catalytic domain superfamily | Homologous Superfamily | |
| IPR003018 | GAF domain | Domain | |
| IPR029016 | GAF-like domain superfamily | Homologous Superfamily | |
| IPR023088 | 3'5'-cyclic nucleotide phosphodiesterase | Family | |
| IPR023174 | 3'5'-cyclic nucleotide phosphodiesterase, conserved site | Conserved Site | |
| IPR003607 | HD/PDEase domain | Domain | |
| IPR002073 | 3'5'-cyclic nucleotide phosphodiesterase, catalytic domain | Domain | |
| IPR036971 | 3'5'-cyclic nucleotide phosphodiesterase, catalytic domain superfamily | Homologous Superfamily | |
| IPR003018 | GAF domain | Domain | |
| IPR029016 | GAF-like domain superfamily | Homologous Superfamily | |
| IPR023088 | 3'5'-cyclic nucleotide phosphodiesterase | Family | |
| IPR023174 | 3'5'-cyclic nucleotide phosphodiesterase, conserved site | Conserved Site |














