Chemical Component Summary | |
|---|---|
| Name | Seladelpar |
| Identifiers | 2-[4-[(2~{R})-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methyl-phenoxy]ethanoic acid |
| Formula | C21 H23 F3 O5 S |
| Molecular Weight | 444.465 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCO[C@H](COc1ccc(cc1)C(F)(F)F)CSc2ccc(c(c2)C)OCC(=O)O |
| InChI | InChI=1S/C21H23F3O5S/c1-3-27-17(11-28-16-6-4-15(5-7-16)21(22,23)24)13-30-18-8-9-19(14(2)10-18)29-12-20(25)26/h4-10,17H,3,11-13H2,1-2H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | JWHYSEDOYMYMNM-QGZVFWFLSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 53 |
| Chiral Atom Count | 1 |
| Bond Count | 54 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12390 |
|---|---|
| Name | Seladelpar |
| Groups | investigational |
| Description | Seladelpar (MBX-8025) has been used in trials studying the treatment of Hyperlipidemia. |
| Synonyms |
|
| Categories |
|
| CAS number | 851528-79-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL230158 |
| PubChem | 11236126 |
| ChEMBL | CHEMBL230158 |
