H43
2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]ethanoic acid
Find entries where: H43
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]ethanoic acid |
| Synonyms | Evocalcet |
| Identifiers | 2-[4-[(3~{S})-3-[[(1~{R})-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]ethanoic acid |
| Formula | C24 H26 N2 O2 |
| Molecular Weight | 374.475 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@H](c1cccc2c1cccc2)N[C@H]3CCN(C3)c4ccc(cc4)CC(=O)O |
| InChI | InChI=1S/C24H26N2O2/c1-17(22-8-4-6-19-5-2-3-7-23(19)22)25-20-13-14-26(16-20)21-11-9-18(10-12-21)15-24(27)28/h2-12,17,20,25H,13-16H2,1H3,(H,27,28)/t17-,20+/m1/s1 |
| InChIKey | RZNUIYPHQFXBAN-XLIONFOSSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 54 |
| Chiral Atom Count | 2 |
| Bond Count | 57 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB12388 |
|---|---|
| Name | Evocalcet |
| Groups | investigational |
| Description | Evocalcet has been used in trials studying the treatment of Hyperparathyroidism and Secondary Hyperparathyroidism. |
| Synonyms | Evocalcet |
| CAS number | 870964-67-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4297621 |
| PubChem | 71242808 |
| ChEMBL | CHEMBL4297621 |
