GNO
2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonyl-amino]methyl]phenoxy]ethanoic acid
Find entries where: GNO
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonyl-amino]methyl]phenoxy]ethanoic acid |
| Identifiers | 2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonyl-amino]methyl]phenoxy]ethanoic acid |
| Formula | C24 H22 N4 O5 S |
| Molecular Weight | 478.52 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cc(cc(c1)OCC(=O)O)CN(Cc2ccc(cc2)n3cccn3)S(=O)(=O)c4cccnc4 |
| InChI | InChI=1S/C24H22N4O5S/c29-24(30)18-33-22-5-1-4-20(14-22)17-27(34(31,32)23-6-2-11-25-15-23)16-19-7-9-21(10-8-19)28-13-3-12-26-28/h1-15H,16-18H2,(H,29,30) |
| InChIKey | MFFBXYNKZHTCEY-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 0 |
| Bond Count | 59 |
| Aromatic Bond Count | 23 |
Drug Info: DrugBank
| DrugBank ID | DB12623 |
|---|---|
| Name | Taprenepag |
| Groups | investigational |
| Description | Taprenepag has been used in trials studying the treatment of Ocular Hypertension and Glaucoma, Open-Angle. |
| Synonyms | Taprenepag |
| Categories |
|
| CAS number | 752187-80-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2107783 |
| PubChem | 18376177 |
| ChEMBL | CHEMBL2107783 |
