Chemical Component Summary | |
|---|---|
| Name | Lofentanil |
| Synonyms | methyl (3R,4S)-3-methyl-1-(2-phenylethyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate |
| Identifiers | methyl (3~{R},4~{S})-3-methyl-1-(2-phenylethyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate |
| Formula | C25 H32 N2 O3 |
| Molecular Weight | 408.533 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCC(=O)N(c1ccccc1)[C@]2(CCN(C[C@H]2C)CCc3ccccc3)C(=O)OC |
| InChI | InChI=1S/C25H32N2O3/c1-4-23(28)27(22-13-9-6-10-14-22)25(24(29)30-3)16-18-26(19-20(25)2)17-15-21-11-7-5-8-12-21/h5-14,20H,4,15-19H2,1-3H3/t20-,25+/m1/s1 |
| InChIKey | IMYHGORQCPYVBZ-NLFFAJNJSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 62 |
| Chiral Atom Count | 2 |
| Bond Count | 64 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB09174 |
|---|---|
| Name | Lofentanil |
| Groups | illicit |
| Description | Lofentanil is an analog of fentanyl and is one of the most potent opioids available today. It displays most similarity to carfentanil (4-carbomethoxyfentanyl) and is considered to be slightly more potent than this drug. |
| Synonyms | Lofentanil |
| Categories |
|
| CAS number | 61380-40-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL28198 |
| PubChem | 10070040 |
| ChEMBL | CHEMBL28198 |
