A3V
(1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol
Find entries where: A3V
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol |
| Identifiers | (1R)-3-azanyl-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol |
| Formula | C16 H25 N O2 |
| Molecular Weight | 263.375 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cc(cc(c1)OCC2CCCCC2)[C@@H](CCN)O |
| InChI | InChI=1S/C16H25NO2/c17-10-9-16(18)14-7-4-8-15(11-14)19-12-13-5-2-1-3-6-13/h4,7-8,11,13,16,18H,1-3,5-6,9-10,12,17H2/t16-/m1/s1 |
| InChIKey | WJIGGYYSZBWCGC-MRXNPFEDSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 44 |
| Chiral Atom Count | 1 |
| Bond Count | 45 |
| Aromatic Bond Count | 6 |
Drug Info: DrugBank
| DrugBank ID | DB12608 |
|---|---|
| Name | Emixustat |
| Groups | investigational |
| Description | Emixustat has been used in trials studying the treatment of Geographic Atrophy, Age-Related Macular Degeneration, and Dry Age-related Macular Degeneration. |
| Synonyms | Emixustat |
| Categories |
|
| CAS number | 1141777-14-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 25221720 |
| ChEMBL | CHEMBL2107821 |
