8VP
2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(1,2,3,4-tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole
Find entries where: 8VP
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(1,2,3,4-tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
| Synonyms | MBX-2982 |
| Identifiers | 2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-4-[[4-(1,2,3,4-tetrazol-1-yl)phenoxy]methyl]-1,3-thiazole |
| Formula | C22 H24 N8 O S |
| Molecular Weight | 448.544 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1cnc(nc1)N2CCC(CC2)c3nc(cs3)COc4ccc(cc4)n5cnnn5 |
| InChI | InChI=1S/C22H24N8OS/c1-2-16-11-23-22(24-12-16)29-9-7-17(8-10-29)21-26-18(14-32-21)13-31-20-5-3-19(4-6-20)30-15-25-27-28-30/h3-6,11-12,14-15,17H,2,7-10,13H2,1H3 |
| InChIKey | NFTMKHWBOINJGM-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 0 |
| Bond Count | 60 |
| Aromatic Bond Count | 22 |
Drug Info: DrugBank
| DrugBank ID | DB12345 |
|---|---|
| Name | MBX-2982 |
| Groups | investigational |
| Description | MBX-2982 has been used in trials studying the treatment of Diabetes. |
| Synonyms | MBX-2982 |
| Categories | Sulfur Compounds |
| CAS number | 1037792-44-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3260505 |
| PubChem | 25025505 |
| ChEMBL | CHEMBL3260505 |
