7I0
(2E)-3-{4-[(1E)-2-(2-chloro-4-fluorophenyl)-1-(2H-indazol-5-yl)but-1-en-1-yl]phenyl}prop-2-enoic acid
Find entries where: 7I0
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (2E)-3-{4-[(1E)-2-(2-chloro-4-fluorophenyl)-1-(2H-indazol-5-yl)but-1-en-1-yl]phenyl}prop-2-enoic acid |
| Identifiers | (~{E})-3-[4-[(~{E})-2-(2-chloranyl-4-fluoranyl-phenyl)-1-(2~{H}-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| Formula | C26 H20 Cl F N2 O2 |
| Molecular Weight | 446.901 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC/C(=C(/c1ccc(cc1)/C=C/C(=O)O)\c2ccc3c(c2)c[nH]n3)/c4ccc(cc4Cl)F |
| InChI | InChI=1S/C26H20ClFN2O2/c1-2-21(22-10-9-20(28)14-23(22)27)26(18-8-11-24-19(13-18)15-29-30-24)17-6-3-16(4-7-17)5-12-25(31)32/h3-15H,2H2,1H3,(H,29,30)(H,31,32)/b12-5+,26-21+ |
| InChIKey | BURHGPHDEVGCEZ-KJGLQBJMSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 52 |
| Chiral Atom Count | 0 |
| Bond Count | 55 |
| Aromatic Bond Count | 22 |
Drug Info: DrugBank
| DrugBank ID | DB12253 |
|---|---|
| Name | GDC-0810 |
| Groups | investigational |
| Description | ARN-810 has been used in trials studying the basic science and treatment of Breast Cancer. |
| Synonyms | GDC-0810 |
| Categories |
|
| CAS number | 1365888-06-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3581693 |
| PubChem | 56941241 |
| ChEMBL | CHEMBL3581693 |
