Chemical Component Summary

NameAC-(D)PHE-PRO-BOROARG-OH
Identifiers[(1R)-1-[[(2S)-1-[(2R)-2-acetamido-3-phenyl-propanoyl]pyrrolidin-2-yl]carbonylamino]-4-carbamimidamido-butyl]boronic acid
FormulaC21 H33 B N6 O5
Molecular Weight460.33
TypeNON-POLYMER
Isomeric SMILESCC(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(N)=N)B(O)O
InChIInChI=1S/C21H33BN6O5/c1-14(29)26-16(13-15-7-3-2-4-8-15)20(31)28-12-6-9-17(28)19(30)27-18(22(32)33)10-5-11-25-21(23)24/h2-4,7-8,16-18,32-33H,5-6,9-13H2,1H3,(H,26,29)(H,27,30)(H4,23,24,25)/t16-,17+,18+/m1/s1
InChIKeyFXFYPTZERULUBS-SQNIBIBYSA-N

Chemical Details

Formal Charge0
Atom Count66
Chiral Atom Count3
Chiral AtomsC1, C14, C7
Bond Count67
Aromatic Bond Count6
Leaving Atomsn/a